C34H36O5 — CID 11756568
(1R,2S,3S,4R,6R)-2,3,4,6-tetrakis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 11756568) has the molecular formula C34H36O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is (1R,2S,3S,4R,6R)-2,3,4,6-tetrakis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2S,3S,4R,6R)-2,3,4,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11756568 |
| Molecular Formula | C34H36O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (1R,2S,3S,4R,6R)-2,3,4,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | O[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H36O5/c35-32-30(36-22-26-13-5-1-6-14-26)21-31(37-23-27-15-7-2-8-16-27)33(38-24-28-17-9-3-10-18-28)34(32)39-25-29-19-11-4-12-20-29/h1-20,30-35H,21-25H2/t30-,31?,32-,33+,34+/m1/s1 |
| InChIKey | WMWXBQJTCXRNQV-VBQYTDQYSA-N |
| XLogP | 6.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |