C27H31NO5 — CID 15755845
(1S,2R,3R,4R,6S)-2,4-bis(phenylmethoxy)-6-(phenylmethoxyamino)cyclohexane-1,3-diol (PubChem CID 15755845) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (1S,2R,3R,4R,6S)-2,4-bis(phenylmethoxy)-6-(phenylmethoxyamino)cyclohexane-1,3-diol.
| Compound Name | (1S,2R,3R,4R,6S)-2,4-bis(phenylmethoxy)-6-(phenylmethoxyamino)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 15755845 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (1S,2R,3R,4R,6S)-2,4-bis(phenylmethoxy)-6-(phenylmethoxyamino)cyclohexane-1,3-diol |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)[C@H](O)[C@H](OCc2ccccc2)C[C@@H]1NOCc1ccccc1 |
| InChI | InChI=1S/C27H31NO5/c29-25-23(28-33-19-22-14-8-3-9-15-22)16-24(31-17-20-10-4-1-5-11-20)26(30)27(25)32-18-21-12-6-2-7-13-21/h1-15,23-30H,16-19H2/t23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | HXWKIJWJABNWHI-XQDVFQCSSA-N |
| XLogP | 3.37 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|