C21H26O4 — CID 10569320
(1S,2S,3R,4R,6R)-4-methyl-3,6-bis(phenylmethoxy)cyclohexane-1,2-diol (PubChem CID 10569320) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (1S,2S,3R,4R,6R)-4-methyl-3,6-bis(phenylmethoxy)cyclohexane-1,2-diol.
| Compound Name | (1S,2S,3R,4R,6R)-4-methyl-3,6-bis(phenylmethoxy)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 10569320 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (1S,2S,3R,4R,6R)-4-methyl-3,6-bis(phenylmethoxy)cyclohexane-1,2-diol |
| SMILES | CC1C[C@@H](OCc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H26O4/c1-15-12-18(24-13-16-8-4-2-5-9-16)19(22)20(23)21(15)25-14-17-10-6-3-7-11-17/h2-11,15,18-23H,12-14H2,1H3/t15?,18-,19-,20+,21-/m1/s1 |
| InChIKey | JDDUJHUAWFMJLX-ZGMNTDJNSA-N |
| XLogP | 2.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |