C16H17ClFN — CID 87082724
(3-fluorophenyl)methyl-[(1R,2S)-2-phenylcyclopropyl]azanium chloride (PubChem CID 87082724) has the molecular formula C16H17ClFN and a molecular weight of 277.77 g/mol. Its IUPAC name is (3-fluorophenyl)methyl-[(1R,2S)-2-phenylcyclopropyl]azanium chloride.
| Compound Name | (3-fluorophenyl)methyl-[(1R,2S)-2-phenylcyclopropyl]azanium chloride |
|---|---|
| PubChem CID | 87082724 |
| Molecular Formula | C16H17ClFN |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (3-fluorophenyl)methyl-[(1R,2S)-2-phenylcyclopropyl]azanium chloride |
| SMILES | Fc1cccc(C[NH2+][C@@H]2C[C@H]2c2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C16H16FN.ClH/c17-14-8-4-5-12(9-14)11-18-16-10-15(16)13-6-2-1-3-7-13;/h1-9,15-16,18H,10-11H2;1H/t15-,16+;/m0./s1 |
| InChIKey | ZAMCKGRHWXHNRL-IDVLALEDSA-N |
| XLogP | -0.55 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |