C17H17FN2O — CID 135364827
(3R,5R)-3-[(3-fluorophenyl)methyl]-5-phenylpiperazin-2-one (PubChem CID 135364827) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is (3R,5R)-3-[(3-fluorophenyl)methyl]-5-phenylpiperazin-2-one.
| Compound Name | (3R,5R)-3-[(3-fluorophenyl)methyl]-5-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 135364827 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (3R,5R)-3-[(3-fluorophenyl)methyl]-5-phenylpiperazin-2-one |
| SMILES | O=C1NC[C@@H](c2ccccc2)N[C@@H]1Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H17FN2O/c18-14-8-4-5-12(9-14)10-15-17(21)19-11-16(20-15)13-6-2-1-3-7-13/h1-9,15-16,20H,10-11H2,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | UMTDEIRGYIGQTN-CVEARBPZSA-N |
| XLogP | 2.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |