C17H24N2O — CID 132820346
(3S,5S)-3-benzyl-5-cyclohexylpiperazin-2-one (PubChem CID 132820346) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (3S,5S)-3-benzyl-5-cyclohexylpiperazin-2-one.
| Compound Name | (3S,5S)-3-benzyl-5-cyclohexylpiperazin-2-one |
|---|---|
| PubChem CID | 132820346 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (3S,5S)-3-benzyl-5-cyclohexylpiperazin-2-one |
| SMILES | O=C1NC[C@H](C2CCCCC2)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c20-17-15(11-13-7-3-1-4-8-13)19-16(12-18-17)14-9-5-2-6-10-14/h1,3-4,7-8,14-16,19H,2,5-6,9-12H2,(H,18,20)/t15-,16+/m0/s1 |
| InChIKey | DZQQTLCWUYSJQF-JKSUJKDBSA-N |
| XLogP | 2.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |