C18H27NO — CID 102259871
(2S,4R,6S)-2-benzyl-6-cyclohexylpiperidin-4-ol (PubChem CID 102259871) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (2S,4R,6S)-2-benzyl-6-cyclohexylpiperidin-4-ol.
| Compound Name | (2S,4R,6S)-2-benzyl-6-cyclohexylpiperidin-4-ol |
|---|---|
| PubChem CID | 102259871 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (2S,4R,6S)-2-benzyl-6-cyclohexylpiperidin-4-ol |
| SMILES | O[C@@H]1C[C@H](Cc2ccccc2)N[C@H](C2CCCCC2)C1 |
| InChI | InChI=1S/C18H27NO/c20-17-12-16(11-14-7-3-1-4-8-14)19-18(13-17)15-9-5-2-6-10-15/h1,3-4,7-8,15-20H,2,5-6,9-13H2/t16-,17+,18-/m0/s1 |
| InChIKey | JAONUYSSDPLZQZ-KSZLIROESA-N |
| XLogP | 3.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |