C18H27NO2 — CID 78150855
3-(benzylamino)-4-cyclohexylcyclopentane-1,2-diol (PubChem CID 78150855) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-(benzylamino)-4-cyclohexylcyclopentane-1,2-diol.
| Compound Name | 3-(benzylamino)-4-cyclohexylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 78150855 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-(benzylamino)-4-cyclohexylcyclopentane-1,2-diol |
| SMILES | OC1CC(C2CCCCC2)C(NCc2ccccc2)C1O |
| InChI | InChI=1S/C18H27NO2/c20-16-11-15(14-9-5-2-6-10-14)17(18(16)21)19-12-13-7-3-1-4-8-13/h1,3-4,7-8,14-21H,2,5-6,9-12H2 |
| InChIKey | SMFVVONIUYQRTI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |