C14H20ClNO2 — CID 131856617
cis-(1S,2R)-2-(benzylamino)cyclohexane-1-carboxylic acid;hydrochloride (PubChem CID 131856617) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is cis-(1S,2R)-2-(benzylamino)cyclohexane-1-carboxylic acid;hydrochloride.
| Compound Name | cis-(1S,2R)-2-(benzylamino)cyclohexane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 131856617 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | cis-(1S,2R)-2-(benzylamino)cyclohexane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@H]1CCCC[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C14H19NO2.ClH/c16-14(17)12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11;/h1-3,6-7,12-13,15H,4-5,8-10H2,(H,16,17);1H/t12-,13+;/m0./s1 |
| InChIKey | MTSYWZIIJIIYAA-JHEYCYPBSA-N |
| XLogP | 2.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |