C20H23NO2 — CID 101135573
cis-benzyl (1S,2R)-2-(benzylamino)cyclopentane-1-carboxylate (PubChem CID 101135573) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is cis-benzyl (1S,2R)-2-(benzylamino)cyclopentane-1-carboxylate.
| Compound Name | cis-benzyl (1S,2R)-2-(benzylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101135573 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | cis-benzyl (1S,2R)-2-(benzylamino)cyclopentane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CCC[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c22-20(23-15-17-10-5-2-6-11-17)18-12-7-13-19(18)21-14-16-8-3-1-4-9-16/h1-6,8-11,18-19,21H,7,12-15H2/t18-,19+/m0/s1 |
| InChIKey | IOJCTRIIGCQJBL-RBUKOAKNSA-N |
| XLogP | 3.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |