C14H22N2 — CID 149139761
2-N-benzyl-1-N-methylcyclohexane-1,2-diamine (PubChem CID 149139761) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-N-benzyl-1-N-methylcyclohexane-1,2-diamine.
| Compound Name | 2-N-benzyl-1-N-methylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 149139761 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-N-benzyl-1-N-methylcyclohexane-1,2-diamine |
| SMILES | CNC1CCCCC1NCc1ccccc1 |
| InChI | InChI=1S/C14H22N2/c1-15-13-9-5-6-10-14(13)16-11-12-7-3-2-4-8-12/h2-4,7-8,13-16H,5-6,9-11H2,1H3 |
| InChIKey | RHNBMPYDQHIAGX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |