C17H28N2 — CID 101206907
trans-(1R,2R)-1-N-benzyl-2-N,2-N-diethylcyclohexane-1,2-diamine (PubChem CID 101206907) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-benzyl-2-N,2-N-diethylcyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N-benzyl-2-N,2-N-diethylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 101206907 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | trans-(1R,2R)-1-N-benzyl-2-N,2-N-diethylcyclohexane-1,2-diamine |
| SMILES | CCN(CC)[C@@H]1CCCC[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C17H28N2/c1-3-19(4-2)17-13-9-8-12-16(17)18-14-15-10-6-5-7-11-15/h5-7,10-11,16-18H,3-4,8-9,12-14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | SZBLEPARPNPVKZ-IAGOWNOFSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |