C32H34N2 — CID 122225965
trans-(1R,2R)-1-N,2-N-bis[(4-phenylphenyl)methyl]cyclohexane-1,2-diamine (PubChem CID 122225965) has the molecular formula C32H34N2 and a molecular weight of 446.64 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis[(4-phenylphenyl)methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis[(4-phenylphenyl)methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 122225965 |
| Molecular Formula | C32H34N2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis[(4-phenylphenyl)methyl]cyclohexane-1,2-diamine |
| SMILES | c1ccc(-c2ccc(CN[C@@H]3CCCC[C@H]3NCc3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34N2/c1-3-9-27(10-4-1)29-19-15-25(16-20-29)23-33-31-13-7-8-14-32(31)34-24-26-17-21-30(22-18-26)28-11-5-2-6-12-28/h1-6,9-12,15-22,31-34H,7-8,13-14,23-24H2/t31-,32-/m1/s1 |
| InChIKey | AMBKEVRBRFVQBG-ROJLCIKYSA-N |
| XLogP | 7.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |