C20H23NO3 — CID 110097453
2-[4-[[[(1S,2S)-2-hydroxycyclohexyl]amino]methyl]phenyl]benzoic acid (PubChem CID 110097453) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[4-[[[(1S,2S)-2-hydroxycyclohexyl]amino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[[(1S,2S)-2-hydroxycyclohexyl]amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 110097453 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-[4-[[[(1S,2S)-2-hydroxycyclohexyl]amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(CN[C@H]2CCCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H23NO3/c22-19-8-4-3-7-18(19)21-13-14-9-11-15(12-10-14)16-5-1-2-6-17(16)20(23)24/h1-2,5-6,9-12,18-19,21-22H,3-4,7-8,13H2,(H,23,24)/t18-,19-/m0/s1 |
| InChIKey | ZLLJRXZHKMEIBC-OALUTQOASA-N |
| XLogP | 3.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |