C14H17NO4 — CID 94415091
2-[[(1R,2R)-2-hydroxycyclohexyl]carbamoyl]benzoic acid (PubChem CID 94415091) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-hydroxycyclohexyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[(1R,2R)-2-hydroxycyclohexyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 94415091 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[[(1R,2R)-2-hydroxycyclohexyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C14H17NO4/c16-12-8-4-3-7-11(12)15-13(17)9-5-1-2-6-10(9)14(18)19/h1-2,5-6,11-12,16H,3-4,7-8H2,(H,15,17)(H,18,19)/t11-,12-/m1/s1 |
| InChIKey | QHGGYQUPBMXEDQ-VXGBXAGGSA-N |
| XLogP | 1.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |