C16H24N2O2 — CID 107223849
N-[(1S,2S)-2-hydroxycyclohexyl]-2-(propan-2-ylamino)benzamide (PubChem CID 107223849) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-(propan-2-ylamino)benzamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(propan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 107223849 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(propan-2-ylamino)benzamide |
| SMILES | CC(C)Nc1ccccc1C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H24N2O2/c1-11(2)17-13-8-4-3-7-12(13)16(20)18-14-9-5-6-10-15(14)19/h3-4,7-8,11,14-15,17,19H,5-6,9-10H2,1-2H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | WNGASDTWFZCEJJ-GJZGRUSLSA-N |
| XLogP | 2.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |