C14H16F3NO2S — CID 104957142
N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 104957142) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 104957142 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2S/c15-14(16,17)21-12-8-4-1-5-9(12)13(20)18-10-6-2-3-7-11(10)19/h1,4-5,8,10-11,19H,2-3,6-7H2,(H,18,20)/t10-,11-/m0/s1 |
| InChIKey | XBOYFJVOJBGBJZ-QWRGUYRKSA-N |
| XLogP | 3.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |