C14H15F4NO2 — CID 104956750
2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(trifluoromethyl)benzamide (PubChem CID 104956750) has the molecular formula C14H15F4NO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is 2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 104956750 |
| Molecular Formula | C14H15F4NO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C14H15F4NO2/c15-12-8(4-3-5-9(12)14(16,17)18)13(21)19-10-6-1-2-7-11(10)20/h3-5,10-11,20H,1-2,6-7H2,(H,19,21)/t10-,11-/m0/s1 |
| InChIKey | OFTWFQAZNLJUEW-QWRGUYRKSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |