C15H18N2O3 — CID 60941055
2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylcarbamoyl)benzoic acid (PubChem CID 60941055) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylcarbamoyl)benzoic acid.
| Compound Name | 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 60941055 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylcarbamoyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NC1CCN2CCCC12 |
| InChI | InChI=1S/C15H18N2O3/c18-14(10-4-1-2-5-11(10)15(19)20)16-12-7-9-17-8-3-6-13(12)17/h1-2,4-5,12-13H,3,6-9H2,(H,16,18)(H,19,20) |
| InChIKey | FDJRQORLDLGIGI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |