C14H20N4O — CID 62176030
N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(methylamino)pyridine-3-carboxamide (PubChem CID 62176030) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62176030 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncccc1C(=O)NC1CCN2CCCC12 |
| InChI | InChI=1S/C14H20N4O/c1-15-13-10(4-2-7-16-13)14(19)17-11-6-9-18-8-3-5-12(11)18/h2,4,7,11-12H,3,5-6,8-9H2,1H3,(H,15,16)(H,17,19) |
| InChIKey | GXDUZCXTVGFGGF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |