C18H26N2O2 — CID 171674975
N-[(1S,2R)-2-hydroxycyclohexyl]-2-(pyrrolidin-1-ylmethyl)benzamide (PubChem CID 171674975) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxycyclohexyl]-2-(pyrrolidin-1-ylmethyl)benzamide.
| Compound Name | N-[(1S,2R)-2-hydroxycyclohexyl]-2-(pyrrolidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 171674975 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-[(1S,2R)-2-hydroxycyclohexyl]-2-(pyrrolidin-1-ylmethyl)benzamide |
| SMILES | O=C(N[C@H]1CCCC[C@H]1O)c1ccccc1CN1CCCC1 |
| InChI | InChI=1S/C18H26N2O2/c21-17-10-4-3-9-16(17)19-18(22)15-8-2-1-7-14(15)13-20-11-5-6-12-20/h1-2,7-8,16-17,21H,3-6,9-13H2,(H,19,22)/t16-,17+/m0/s1 |
| InChIKey | CKJNJCQVBVXFFC-DLBZAZTESA-N |
| XLogP | 2.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |