C12H17NO2 — CID 163753125
(1R,2S,3R)-3-(benzylamino)cyclopentane-1,2-diol (PubChem CID 163753125) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (1R,2S,3R)-3-(benzylamino)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-(benzylamino)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 163753125 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (1R,2S,3R)-3-(benzylamino)cyclopentane-1,2-diol |
| SMILES | O[C@@H]1[C@H](O)CC[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c14-11-7-6-10(12(11)15)13-8-9-4-2-1-3-5-9/h1-5,10-15H,6-8H2/t10-,11-,12+/m1/s1 |
| InChIKey | LRTOSSHKRXODOP-UTUOFQBUSA-N |
| XLogP | 0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |