C15H21NO — CID 7155133
(1S,2R,4S)-2-(benzylamino)-4-ethenylcyclohexan-1-ol (PubChem CID 7155133) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (1S,2R,4S)-2-(benzylamino)-4-ethenylcyclohexan-1-ol.
| Compound Name | (1S,2R,4S)-2-(benzylamino)-4-ethenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 7155133 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (1S,2R,4S)-2-(benzylamino)-4-ethenylcyclohexan-1-ol |
| SMILES | C=C[C@H]1CC[C@H](O)[C@H](NCc2ccccc2)C1 |
| InChI | InChI=1S/C15H21NO/c1-2-12-8-9-15(17)14(10-12)16-11-13-6-4-3-5-7-13/h2-7,12,14-17H,1,8-11H2/t12-,14+,15-/m0/s1 |
| InChIKey | FRKITRFPSKWDEJ-CFVMTHIKSA-N |
| XLogP | 2.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|