C10H8FNO3 — CID 138393631
(4S)-4-[(3-fluorophenyl)methyl]-1,3-oxazolidine-2,5-dione (PubChem CID 138393631) has the molecular formula C10H8FNO3 and a molecular weight of 209.18 g/mol. Its IUPAC name is (4S)-4-[(3-fluorophenyl)methyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | (4S)-4-[(3-fluorophenyl)methyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 138393631 |
| Molecular Formula | C10H8FNO3 |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (4S)-4-[(3-fluorophenyl)methyl]-1,3-oxazolidine-2,5-dione |
| SMILES | O=C1N[C@@H](Cc2cccc(F)c2)C(=O)O1 |
| InChI | InChI=1S/C10H8FNO3/c11-7-3-1-2-6(4-7)5-8-9(13)15-10(14)12-8/h1-4,8H,5H2,(H,12,14)/t8-/m0/s1 |
| InChIKey | AQPGFQSDVCECCV-QMMMGPOBSA-N |
| XLogP | 1.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|