C10H7Cl2NO3 — CID 137332938
4-[(2,3-dichlorophenyl)methyl]-1,3-oxazolidine-2,5-dione (PubChem CID 137332938) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 4-[(2,3-dichlorophenyl)methyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-[(2,3-dichlorophenyl)methyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 137332938 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 4-[(2,3-dichlorophenyl)methyl]-1,3-oxazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2cccc(Cl)c2Cl)C(=O)O1 |
| InChI | InChI=1S/C10H7Cl2NO3/c11-6-3-1-2-5(8(6)12)4-7-9(14)16-10(15)13-7/h1-3,7H,4H2,(H,13,15) |
| InChIKey | UELXXCHQGMLPQO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|