C12H14Cl2O — CID 107310340
3-[(2,3-dichlorophenyl)methyl]cyclopentan-1-ol (PubChem CID 107310340) has the molecular formula C12H14Cl2O and a molecular weight of 245.15 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methyl]cyclopentan-1-ol.
| Compound Name | 3-[(2,3-dichlorophenyl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 107310340 |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methyl]cyclopentan-1-ol |
| SMILES | OC1CCC(Cc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C12H14Cl2O/c13-11-3-1-2-9(12(11)14)6-8-4-5-10(15)7-8/h1-3,8,10,15H,4-7H2 |
| InChIKey | FRJPEEXTSKPORS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |