C12H14ClFO — CID 103050503
3-[(5-chloro-2-fluorophenyl)methyl]cyclopentan-1-ol (PubChem CID 103050503) has the molecular formula C12H14ClFO and a molecular weight of 228.69 g/mol. Its IUPAC name is 3-[(5-chloro-2-fluorophenyl)methyl]cyclopentan-1-ol.
| Compound Name | 3-[(5-chloro-2-fluorophenyl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 103050503 |
| Molecular Formula | C12H14ClFO |
| Molecular Weight | 228.69 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-[(5-chloro-2-fluorophenyl)methyl]cyclopentan-1-ol |
| SMILES | OC1CCC(Cc2cc(Cl)ccc2F)C1 |
| InChI | InChI=1S/C12H14ClFO/c13-10-2-4-12(14)9(7-10)5-8-1-3-11(15)6-8/h2,4,7-8,11,15H,1,3,5-6H2 |
| InChIKey | VFKLCSKURLDFOE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |