C10H8Cl2O2 — CID 71772683
2-[(2,3-dichlorophenyl)methyl]-1,3-dioxole (PubChem CID 71772683) has the molecular formula C10H8Cl2O2 and a molecular weight of 231.08 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methyl]-1,3-dioxole.
| Compound Name | 2-[(2,3-dichlorophenyl)methyl]-1,3-dioxole |
|---|---|
| PubChem CID | 71772683 |
| Molecular Formula | C10H8Cl2O2 |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methyl]-1,3-dioxole |
| SMILES | Clc1cccc(CC2OC=CO2)c1Cl |
| InChI | InChI=1S/C10H8Cl2O2/c11-8-3-1-2-7(10(8)12)6-9-13-4-5-14-9/h1-5,9H,6H2 |
| InChIKey | CGDUJLXOUCZPMW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |