C7H5Cl2I — CID 107310418
1,2-dichloro-3-(iodomethyl)benzene (PubChem CID 107310418) has the molecular formula C7H5Cl2I and a molecular weight of 286.93 g/mol. Its IUPAC name is 1,2-dichloro-3-(iodomethyl)benzene.
| Compound Name | 1,2-dichloro-3-(iodomethyl)benzene |
|---|---|
| PubChem CID | 107310418 |
| Molecular Formula | C7H5Cl2I |
| Molecular Weight | 286.93 g/mol |
| Exact Mass | 285.88 |
| IUPAC Name | 1,2-dichloro-3-(iodomethyl)benzene |
| SMILES | Clc1cccc(CI)c1Cl |
| InChI | InChI=1S/C7H5Cl2I/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4H2 |
| InChIKey | FLIBUMVNNAGSRR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|