C8H10Cl2N+ — CID 2060843
(2,3-dichlorophenyl)methyl-methylazanium (PubChem CID 2060843) has the molecular formula C8H10Cl2N+ and a molecular weight of 191.08 g/mol. Its IUPAC name is (2,3-dichlorophenyl)methyl-methylazanium.
| Compound Name | (2,3-dichlorophenyl)methyl-methylazanium |
|---|---|
| PubChem CID | 2060843 |
| Molecular Formula | C8H10Cl2N+ |
| Molecular Weight | 191.08 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | (2,3-dichlorophenyl)methyl-methylazanium |
| SMILES | C[NH2+]Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H9Cl2N/c1-11-5-6-3-2-4-7(9)8(6)10/h2-4,11H,5H2,1H3/p+1 |
| InChIKey | GPHWXLUNCPECQB-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.08 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |