About 1-(azidomethyl)-2,3-dichlorobenzene
1-(azidomethyl)-2,3-dichlorobenzene (PubChem CID 21282659) has the molecular formula C7H5Cl2N3
and a molecular weight of 202.04 g/mol. Its IUPAC name is 1-(azidomethyl)-2,3-dichlorobenzene.
Molecular Properties
| Compound Name | 1-(azidomethyl)-2,3-dichlorobenzene |
| PubChem CID | 21282659 |
| Molecular Formula | C7H5Cl2N3 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 1-(azidomethyl)-2,3-dichlorobenzene |
| SMILES | [N-]=[N+]=NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C7H5Cl2N3/c8-6-3-1-2-5(7(6)9)4-11-12-10/h1-3H,4H2 |
| InChIKey | MDXTUDGGKVGYHO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(azidomethyl)-2,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azidomethyl)-2,3-dichlorobenzene?
The IUPAC name of 1-(azidomethyl)-2,3-dichlorobenzene (CID 21282659) is 1-(azidomethyl)-2,3-dichlorobenzene.
What is the SMILES notation for 1-(azidomethyl)-2,3-dichlorobenzene?
The canonical SMILES for 1-(azidomethyl)-2,3-dichlorobenzene is [N-]=[N+]=NCc1cccc(Cl)c1Cl.
What is the InChIKey of 1-(azidomethyl)-2,3-dichlorobenzene?
The InChIKey is MDXTUDGGKVGYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2N3/c8-6-3-1-2-5(7(6)9)4-11-12-10/h1-3H,4H2.
What are the key properties of 1-(azidomethyl)-2,3-dichlorobenzene?
1-(azidomethyl)-2,3-dichlorobenzene has a molecular weight of 202.04 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azidomethyl)-2,3-dichlorobenzene is sourced from PubChem (CID 21282659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).