C16H16FN — CID 101397690
(2R,3S)-2-(3-fluorophenyl)-3-phenylpyrrolidine (PubChem CID 101397690) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is (2R,3S)-2-(3-fluorophenyl)-3-phenylpyrrolidine.
| Compound Name | (2R,3S)-2-(3-fluorophenyl)-3-phenylpyrrolidine |
|---|---|
| PubChem CID | 101397690 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2R,3S)-2-(3-fluorophenyl)-3-phenylpyrrolidine |
| SMILES | Fc1cccc([C@@H]2NCC[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C16H16FN/c17-14-8-4-7-13(11-14)16-15(9-10-18-16)12-5-2-1-3-6-12/h1-8,11,15-16,18H,9-10H2/t15-,16-/m0/s1 |
| InChIKey | KKMRRCDLLZVTLH-HOTGVXAUSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |