C11H12FNO2 — CID 97001038
(2R,3S)-3-(3-fluorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 97001038) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is (2R,3S)-3-(3-fluorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S)-3-(3-fluorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 97001038 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2R,3S)-3-(3-fluorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1NCC[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C11H12FNO2/c12-8-3-1-2-7(6-8)9-4-5-13-10(9)11(14)15/h1-3,6,9-10,13H,4-5H2,(H,14,15)/t9-,10+/m0/s1 |
| InChIKey | CHUPKCBCMLACTB-VHSXEESVSA-N |
| XLogP | 1.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |