About magnesium;1-ethyl-3-fluorobenzene;bromide
magnesium;1-ethyl-3-fluorobenzene;bromide (PubChem CID 24722724) has the molecular formula C8H8BrFMg
and a molecular weight of 227.36 g/mol. Its IUPAC name is magnesium;1-ethyl-3-fluorobenzene;bromide.
Molecular Properties
| Compound Name | magnesium;1-ethyl-3-fluorobenzene;bromide |
| PubChem CID | 24722724 |
| Molecular Formula | C8H8BrFMg |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | magnesium;1-ethyl-3-fluorobenzene;bromide |
| SMILES | [Br-].[CH2-]Cc1cccc(F)c1.[Mg+2] |
| InChI | InChI=1S/C8H8F.BrH.Mg/c1-2-7-4-3-5-8(9)6-7;;/h3-6H,1-2H2;1H;/q-1;;+2/p-1 |
| InChIKey | JPXYCVSTEYCFJG-UHFFFAOYSA-M |
| XLogP | -1.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1-ethyl-3-fluorobenzene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-ethyl-3-fluorobenzene;bromide?
The IUPAC name of magnesium;1-ethyl-3-fluorobenzene;bromide (CID 24722724) is magnesium;1-ethyl-3-fluorobenzene;bromide.
What is the SMILES notation for magnesium;1-ethyl-3-fluorobenzene;bromide?
The canonical SMILES for magnesium;1-ethyl-3-fluorobenzene;bromide is [Br-].[CH2-]Cc1cccc(F)c1.[Mg+2].
What is the InChIKey of magnesium;1-ethyl-3-fluorobenzene;bromide?
The InChIKey is JPXYCVSTEYCFJG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8F.BrH.Mg/c1-2-7-4-3-5-8(9)6-7;;/h3-6H,1-2H2;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1-ethyl-3-fluorobenzene;bromide?
magnesium;1-ethyl-3-fluorobenzene;bromide has a molecular weight of 227.36 g/mol, XLogP of -1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-ethyl-3-fluorobenzene;bromide is sourced from PubChem (CID 24722724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).