About CID 175350764
CID 175350764 (PubChem CID 175350764) has the molecular formula C7H8BBrFO2
and a molecular weight of 233.85 g/mol.
Molecular Properties
| Compound Name | CID 175350764 |
| PubChem CID | 175350764 |
| Molecular Formula | C7H8BBrFO2 |
| Molecular Weight | 233.85 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | — |
| SMILES | Fc1cccc(CBr)c1.O[B]O |
| InChI | InChI=1S/C7H6BrF.BH2O2/c8-5-6-2-1-3-7(9)4-6;2-1-3/h1-4H,5H2;2-3H |
| InChIKey | SYNPKWQDYZMWIT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.85 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175350764 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175350764?
The IUPAC name of CID 175350764 (CID 175350764) is not available.
What is the SMILES notation for CID 175350764?
The canonical SMILES for CID 175350764 is Fc1cccc(CBr)c1.O[B]O.
What is the InChIKey of CID 175350764?
The InChIKey is SYNPKWQDYZMWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrF.BH2O2/c8-5-6-2-1-3-7(9)4-6;2-1-3/h1-4H,5H2;2-3H.
What are the key properties of CID 175350764?
CID 175350764 has a molecular weight of 233.85 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175350764 is sourced from PubChem (CID 175350764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).