C19H19OP — CID 153280955
[benzyl(cyclopenta-2,4-dien-1-yl)phosphoryl]methylbenzene (PubChem CID 153280955) has the molecular formula C19H19OP and a molecular weight of 294.33 g/mol. Its IUPAC name is [benzyl(cyclopenta-2,4-dien-1-yl)phosphoryl]methylbenzene.
| Compound Name | [benzyl(cyclopenta-2,4-dien-1-yl)phosphoryl]methylbenzene |
|---|---|
| PubChem CID | 153280955 |
| Molecular Formula | C19H19OP |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [benzyl(cyclopenta-2,4-dien-1-yl)phosphoryl]methylbenzene |
| SMILES | O=P(Cc1ccccc1)(Cc1ccccc1)C1C=CC=C1 |
| InChI | InChI=1S/C19H19OP/c20-21(19-13-7-8-14-19,15-17-9-3-1-4-10-17)16-18-11-5-2-6-12-18/h1-14,19H,15-16H2 |
| InChIKey | DEZGDHKNAYUODV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|