C12H12S2 — CID 87420954
2-benzyl-1,3-dithiepine (PubChem CID 87420954) has the molecular formula C12H12S2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-benzyl-1,3-dithiepine.
| Compound Name | 2-benzyl-1,3-dithiepine |
|---|---|
| PubChem CID | 87420954 |
| Molecular Formula | C12H12S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2-benzyl-1,3-dithiepine |
| SMILES | C1=CSC(Cc2ccccc2)SC=C1 |
| InChI | InChI=1S/C12H12S2/c1-2-6-11(7-3-1)10-12-13-8-4-5-9-14-12/h1-9,12H,10H2 |
| InChIKey | LALFMNLPPLHTSA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |