C15H19O3P — CID 100962417
(6-dimethoxyphosphorylcyclohexa-2,4-dien-1-yl)methylbenzene (PubChem CID 100962417) has the molecular formula C15H19O3P and a molecular weight of 278.29 g/mol. Its IUPAC name is (6-dimethoxyphosphorylcyclohexa-2,4-dien-1-yl)methylbenzene.
| Compound Name | (6-dimethoxyphosphorylcyclohexa-2,4-dien-1-yl)methylbenzene |
|---|---|
| PubChem CID | 100962417 |
| Molecular Formula | C15H19O3P |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (6-dimethoxyphosphorylcyclohexa-2,4-dien-1-yl)methylbenzene |
| SMILES | COP(=O)(OC)C1C=CC=CC1Cc1ccccc1 |
| InChI | InChI=1S/C15H19O3P/c1-17-19(16,18-2)15-11-7-6-10-14(15)12-13-8-4-3-5-9-13/h3-11,14-15H,12H2,1-2H3 |
| InChIKey | LGFHUXUJFVZBDR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|