C17H24O3 — CID 10564416
(1S,2S,5R,6S)-2-benzyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol (PubChem CID 10564416) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1S,2S,5R,6S)-2-benzyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol.
| Compound Name | (1S,2S,5R,6S)-2-benzyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 10564416 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1S,2S,5R,6S)-2-benzyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol |
| SMILES | COC[C@H]1[C@@H](O)[C@@H](Cc2ccccc2)C=C[C@H]1COC |
| InChI | InChI=1S/C17H24O3/c1-19-11-15-9-8-14(17(18)16(15)12-20-2)10-13-6-4-3-5-7-13/h3-9,14-18H,10-12H2,1-2H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | GIMPFSGTKQRGBU-TWMKSMIVSA-N |
| XLogP | 2.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|