C12H16O2 — CID 131860879
(2R,3R)-2-(methoxymethyl)-3-(2-phenylethyl)oxirane (PubChem CID 131860879) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2R,3R)-2-(methoxymethyl)-3-(2-phenylethyl)oxirane.
| Compound Name | (2R,3R)-2-(methoxymethyl)-3-(2-phenylethyl)oxirane |
|---|---|
| PubChem CID | 131860879 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2R,3R)-2-(methoxymethyl)-3-(2-phenylethyl)oxirane |
| SMILES | COC[C@H]1O[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-13-9-12-11(14-12)8-7-10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | FOOMRKSEJZXEKL-VXGBXAGGSA-N |
| XLogP | 2.03 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|