C20H22O — CID 177484094
2,5-bis(2-phenylethyl)-2,5-dihydrofuran (PubChem CID 177484094) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 2,5-bis(2-phenylethyl)-2,5-dihydrofuran.
| Compound Name | 2,5-bis(2-phenylethyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 177484094 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2,5-bis(2-phenylethyl)-2,5-dihydrofuran |
| SMILES | C1=CC(CCc2ccccc2)OC1CCc1ccccc1 |
| InChI | InChI=1S/C20H22O/c1-3-7-17(8-4-1)11-13-19-15-16-20(21-19)14-12-18-9-5-2-6-10-18/h1-10,15-16,19-20H,11-14H2 |
| InChIKey | JNXVRNVWWACYAI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|