C14H18O — CID 102376463
4-methyl-6-(2-phenylethyl)-3,6-dihydro-2H-pyran (PubChem CID 102376463) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-methyl-6-(2-phenylethyl)-3,6-dihydro-2H-pyran.
| Compound Name | 4-methyl-6-(2-phenylethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 102376463 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 4-methyl-6-(2-phenylethyl)-3,6-dihydro-2H-pyran |
| SMILES | CC1=CC(CCc2ccccc2)OCC1 |
| InChI | InChI=1S/C14H18O/c1-12-9-10-15-14(11-12)8-7-13-5-3-2-4-6-13/h2-6,11,14H,7-10H2,1H3 |
| InChIKey | ZKAQNEUXSRUGRY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|