C20H28O2 — CID 124776052
[(1R,4S,5S,8S,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol (PubChem CID 124776052) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is [(1R,4S,5S,8S,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol.
| Compound Name | [(1R,4S,5S,8S,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol |
|---|---|
| PubChem CID | 124776052 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | [(1R,4S,5S,8S,9S)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol |
| SMILES | CC1=C[C@H](C)[C@@]2(CO)CO[C@@H](CCc3ccccc3)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C20H28O2/c1-14-11-15(2)20(12-21)13-22-18(19(14)16(20)3)10-9-17-7-5-4-6-8-17/h4-8,11,15-16,18-19,21H,9-10,12-13H2,1-3H3/t15-,16-,18-,19+,20+/m0/s1 |
| InChIKey | XWHWCKHMKQSYBV-FLFBIERCSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|