C22H30O3 — CID 50897958
[(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate (PubChem CID 50897958) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate.
| Compound Name | [(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 50897958 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-(2-phenylethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CO[C@@H](CCc3ccccc3)[C@@H](C(C)=C[C@@H]1C)[C@H]2C |
| InChI | InChI=1S/C22H30O3/c1-15-12-16(2)22(13-24-18(4)23)14-25-20(21(15)17(22)3)11-10-19-8-6-5-7-9-19/h5-9,12,16-17,20-21H,10-11,13-14H2,1-4H3/t16-,17+,20-,21-,22-/m0/s1 |
| InChIKey | FVFIDPRIGRPKRH-OHJZQYHNSA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|