C20H33NO3 — CID 7074718
[(1R,4R,5S,8R,9S)-6,8,9-trimethyl-4-(piperidin-1-ylmethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate (PubChem CID 7074718) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is [(1R,4R,5S,8R,9S)-6,8,9-trimethyl-4-(piperidin-1-ylmethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate.
| Compound Name | [(1R,4R,5S,8R,9S)-6,8,9-trimethyl-4-(piperidin-1-ylmethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 7074718 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | [(1R,4R,5S,8R,9S)-6,8,9-trimethyl-4-(piperidin-1-ylmethyl)-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CO[C@@H](CN3CCCCC3)[C@H](C(C)=C[C@H]1C)[C@@H]2C |
| InChI | InChI=1S/C20H33NO3/c1-14-10-15(2)20(12-23-17(4)22)13-24-18(19(14)16(20)3)11-21-8-6-5-7-9-21/h10,15-16,18-19H,5-9,11-13H2,1-4H3/t15-,16+,18+,19-,20+/m1/s1 |
| InChIKey | DMZHTDDKCJBBRN-QVHQYWGISA-N |
| XLogP | 3.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|