C22H39NO3 — CID 18397702
[(1R,9S)-4-hexyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate (PubChem CID 18397702) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is [(1R,9S)-4-hexyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate.
| Compound Name | [(1R,9S)-4-hexyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 18397702 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | [(1R,9S)-4-hexyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate |
| SMILES | CCCCCCC1OC[C@@]2(COC(=O)NC(C)C)C(C)C=C(C)C1[C@@H]2C |
| InChI | InChI=1S/C22H39NO3/c1-7-8-9-10-11-19-20-16(4)12-17(5)22(13-25-19,18(20)6)14-26-21(24)23-15(2)3/h12,15,17-20H,7-11,13-14H2,1-6H3,(H,23,24)/t17?,18-,19?,20?,22+/m0/s1 |
| InChIKey | ULKPKSITLDMDMJ-DNRPWOFYSA-N |
| XLogP | 5.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|