C19H31NO3 — CID 3707716
(4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-butylcarbamate (PubChem CID 3707716) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is (4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-butylcarbamate.
| Compound Name | (4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-butylcarbamate |
|---|---|
| PubChem CID | 3707716 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-butylcarbamate |
| SMILES | C=CC1OCC2(COC(=O)NCCCC)C(C)C=C(C)C1C2C |
| InChI | InChI=1S/C19H31NO3/c1-6-8-9-20-18(21)23-12-19-11-22-16(7-2)17(15(19)5)13(3)10-14(19)4/h7,10,14-17H,2,6,8-9,11-12H2,1,3-5H3,(H,20,21) |
| InChIKey | MYEOCWYJLVOICZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|