C21H35NO3 — CID 98134037
[(1S,4R,5S,8S,9R)-6,8,9-trimethyl-4-[(E)-prop-1-enyl]-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate (PubChem CID 98134037) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is [(1S,4R,5S,8S,9R)-6,8,9-trimethyl-4-[(E)-prop-1-enyl]-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate.
| Compound Name | [(1S,4R,5S,8S,9R)-6,8,9-trimethyl-4-[(E)-prop-1-enyl]-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate |
|---|---|
| PubChem CID | 98134037 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | [(1S,4R,5S,8S,9R)-6,8,9-trimethyl-4-[(E)-prop-1-enyl]-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate |
| SMILES | C/C=C/[C@H]1OC[C@@]2(COC(=O)NCCCCC)[C@H](C)[C@H]1C(C)=C[C@@H]2C |
| InChI | InChI=1S/C21H35NO3/c1-6-8-9-11-22-20(23)25-14-21-13-24-18(10-7-2)19(17(21)5)15(3)12-16(21)4/h7,10,12,16-19H,6,8-9,11,13-14H2,1-5H3,(H,22,23)/b10-7+/t16-,17+,18+,19+,21-/m0/s1 |
| InChIKey | CSSJDGXKUUQMTC-ILIVQNJESA-N |
| XLogP | 4.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|