C25H35NO5 — CID 25421607
[(1R,4R,5S,8S,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate (PubChem CID 25421607) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is [(1R,4R,5S,8S,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate.
| Compound Name | [(1R,4R,5S,8S,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate |
|---|---|
| PubChem CID | 25421607 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [(1R,4R,5S,8S,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-pentylcarbamate |
| SMILES | CCCCCNC(=O)OC[C@]12CO[C@@H](c3ccc4c(c3)OCO4)[C@H](C(C)=C[C@@H]1C)[C@H]2C |
| InChI | InChI=1S/C25H35NO5/c1-5-6-7-10-26-24(27)29-14-25-13-28-23(22(18(25)4)16(2)11-17(25)3)19-8-9-20-21(12-19)31-15-30-20/h8-9,11-12,17-18,22-23H,5-7,10,13-15H2,1-4H3,(H,26,27)/t17-,18+,22+,23-,25+/m0/s1 |
| InChIKey | BTQCHPRUVKAYMZ-VHAXNVPRSA-N |
| XLogP | 5.24 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|