C26H35NO5 — CID 25421375
[(1R,4S,5S,8R,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate (PubChem CID 25421375) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is [(1R,4S,5S,8R,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate.
| Compound Name | [(1R,4S,5S,8R,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 25421375 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | [(1R,4S,5S,8R,9R)-4-(1,3-benzodioxol-5-yl)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate |
| SMILES | CC1=C[C@@H](C)[C@]2(COC(=O)NC3CCCCC3)CO[C@H](c3ccc4c(c3)OCO4)[C@H]1[C@H]2C |
| InChI | InChI=1S/C26H35NO5/c1-16-11-17(2)26(14-30-25(28)27-20-7-5-4-6-8-20)13-29-24(23(16)18(26)3)19-9-10-21-22(12-19)32-15-31-21/h9-12,17-18,20,23-24H,4-8,13-15H2,1-3H3,(H,27,28)/t17-,18-,23-,24-,26-/m1/s1 |
| InChIKey | OLBNGLBVDWDALE-IOZXGLFCSA-N |
| XLogP | 5.38 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|